C9H7F3O4 — CID 96874577
(2R)-2-hydroxy-2-[3-(trifluoromethoxy)phenyl]acetic acid (PubChem CID 96874577) has the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[3-(trifluoromethoxy)phenyl]acetic acid.
| Compound Name | (2R)-2-hydroxy-2-[3-(trifluoromethoxy)phenyl]acetic acid |
|---|---|
| PubChem CID | 96874577 |
| Molecular Formula | C9H7F3O4 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | (2R)-2-hydroxy-2-[3-(trifluoromethoxy)phenyl]acetic acid |
| SMILES | O=C(O)[C@H](O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H7F3O4/c10-9(11,12)16-6-3-1-2-5(4-6)7(13)8(14)15/h1-4,7,13H,(H,14,15)/t7-/m1/s1 |
| InChIKey | CANNFMISEMEBIT-SSDOTTSWSA-N |
| XLogP | 1.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |