C12H15Cl2NS — CID 96879943
(3R)-3-[(2,6-dichlorophenyl)sulfanylmethyl]piperidine (PubChem CID 96879943) has the molecular formula C12H15Cl2NS and a molecular weight of 276.23 g/mol. Its IUPAC name is (3R)-3-[(2,6-dichlorophenyl)sulfanylmethyl]piperidine.
| Compound Name | (3R)-3-[(2,6-dichlorophenyl)sulfanylmethyl]piperidine |
|---|---|
| PubChem CID | 96879943 |
| Molecular Formula | C12H15Cl2NS |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | (3R)-3-[(2,6-dichlorophenyl)sulfanylmethyl]piperidine |
| SMILES | Clc1cccc(Cl)c1SC[C@@H]1CCCNC1 |
| InChI | InChI=1S/C12H15Cl2NS/c13-10-4-1-5-11(14)12(10)16-8-9-3-2-6-15-7-9/h1,4-5,9,15H,2-3,6-8H2/t9-/m1/s1 |
| InChIKey | HVAZFZURIKESEP-SECBINFHSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |