C6H4Cl2F6 — CID 96880598
(E,4R)-2,4-dichloro-1,1,1,6,6,6-hexafluorohex-2-ene (PubChem CID 96880598) has the molecular formula C6H4Cl2F6 and a molecular weight of 260.99 g/mol. Its IUPAC name is (E,4R)-2,4-dichloro-1,1,1,6,6,6-hexafluorohex-2-ene.
| Compound Name | (E,4R)-2,4-dichloro-1,1,1,6,6,6-hexafluorohex-2-ene |
|---|---|
| PubChem CID | 96880598 |
| Molecular Formula | C6H4Cl2F6 |
| Molecular Weight | 260.99 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | (E,4R)-2,4-dichloro-1,1,1,6,6,6-hexafluorohex-2-ene |
| SMILES | FC(F)(F)C[C@@H](Cl)/C=C(/Cl)C(F)(F)F |
| InChI | InChI=1S/C6H4Cl2F6/c7-3(2-5(9,10)11)1-4(8)6(12,13)14/h1,3H,2H2/b4-1+/t3-/m0/s1 |
| InChIKey | VDWLGNLWODLYEN-AGFFZDDWSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.99 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|