About 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide
5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide (PubChem CID 968945) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide.
Molecular Properties
| Compound Name | 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide |
| PubChem CID | 968945 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide |
| SMILES | CCC(=O)NNC(=O)c1cc(C)[nH]n1 |
| InChI | InChI=1S/C8H12N4O2/c1-3-7(13)11-12-8(14)6-4-5(2)9-10-6/h4H,3H2,1-2H3,(H,9,10)(H,11,13)(H,12,14) |
| InChIKey | XQCXSZMNZPPQEF-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide?
The IUPAC name of 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide (CID 968945) is 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide.
What is the SMILES notation for 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide?
The canonical SMILES for 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide is CCC(=O)NNC(=O)c1cc(C)[nH]n1.
What is the InChIKey of 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide?
The InChIKey is XQCXSZMNZPPQEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c1-3-7(13)11-12-8(14)6-4-5(2)9-10-6/h4H,3H2,1-2H3,(H,9,10)(H,11,13)(H,12,14).
What are the key properties of 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide?
5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide has a molecular weight of 196.21 g/mol, XLogP of -0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N'-propanoyl-1H-pyrazole-3-carbohydrazide is sourced from PubChem (CID 968945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).