About 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline
8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline (PubChem CID 96915582) has the molecular formula C15H19N3
and a molecular weight of 241.34 g/mol. Its IUPAC name is 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline.
Molecular Properties
| Compound Name | 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline |
| PubChem CID | 96915582 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline |
| SMILES | C[C@@H]1CN[C@@H](C)CN1c1cccc2cccnc12 |
| InChI | InChI=1S/C15H19N3/c1-11-10-18(12(2)9-17-11)14-7-3-5-13-6-4-8-16-15(13)14/h3-8,11-12,17H,9-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | DNZVKOLTZUWBEP-NWDGAFQWSA-N |
| XLogP | 2.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline?
The IUPAC name of 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline (CID 96915582) is 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline.
What is the SMILES notation for 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline?
The canonical SMILES for 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline is C[C@@H]1CN[C@@H](C)CN1c1cccc2cccnc12.
What is the InChIKey of 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline?
The InChIKey is DNZVKOLTZUWBEP-NWDGAFQWSA-N. The full InChI is InChI=1S/C15H19N3/c1-11-10-18(12(2)9-17-11)14-7-3-5-13-6-4-8-16-15(13)14/h3-8,11-12,17H,9-10H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline?
8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline has a molecular weight of 241.34 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2R,5S)-2,5-dimethylpiperazin-1-yl]quinoline is sourced from PubChem (CID 96915582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).