C12H15F2N — CID 96923141
3,5-difluoro-N-[(1R,2S)-2-methylcyclopentyl]aniline (PubChem CID 96923141) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is 3,5-difluoro-N-[(1R,2S)-2-methylcyclopentyl]aniline.
| Compound Name | 3,5-difluoro-N-[(1R,2S)-2-methylcyclopentyl]aniline |
|---|---|
| PubChem CID | 96923141 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3,5-difluoro-N-[(1R,2S)-2-methylcyclopentyl]aniline |
| SMILES | C[C@H]1CCC[C@H]1Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H15F2N/c1-8-3-2-4-12(8)15-11-6-9(13)5-10(14)7-11/h5-8,12,15H,2-4H2,1H3/t8-,12+/m0/s1 |
| InChIKey | FNLFLPWYQZHGCT-QPUJVOFHSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |