C15H13ClFNO — CID 96962536
4-chloro-2-[(1S)-6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol (PubChem CID 96962536) has the molecular formula C15H13ClFNO and a molecular weight of 277.73 g/mol. Its IUPAC name is 4-chloro-2-[(1S)-6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol.
| Compound Name | 4-chloro-2-[(1S)-6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol |
|---|---|
| PubChem CID | 96962536 |
| Molecular Formula | C15H13ClFNO |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-chloro-2-[(1S)-6-fluoro-1,2,3,4-tetrahydroisoquinolin-1-yl]phenol |
| SMILES | Oc1ccc(Cl)cc1[C@H]1NCCc2cc(F)ccc21 |
| InChI | InChI=1S/C15H13ClFNO/c16-10-1-4-14(19)13(8-10)15-12-3-2-11(17)7-9(12)5-6-18-15/h1-4,7-8,15,18-19H,5-6H2/t15-/m0/s1 |
| InChIKey | IYSBVLKFCKZIKH-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|