C17H16FNO4 — CID 96979466
[(2S)-oxolan-2-yl]methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate (PubChem CID 96979466) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is [(2S)-oxolan-2-yl]methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate.
| Compound Name | [(2S)-oxolan-2-yl]methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 96979466 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(2S)-oxolan-2-yl]methyl 1-(4-fluorophenyl)-6-oxopyridine-3-carboxylate |
| SMILES | O=C(OC[C@@H]1CCCO1)c1ccc(=O)n(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H16FNO4/c18-13-4-6-14(7-5-13)19-10-12(3-8-16(19)20)17(21)23-11-15-2-1-9-22-15/h3-8,10,15H,1-2,9,11H2/t15-/m0/s1 |
| InChIKey | HXJPFTXSARNOQB-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |