C10H12BrN — CID 96980969
(1R)-6-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 96980969) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is (1R)-6-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R)-6-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 96980969 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (1R)-6-bromo-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C[C@H]1NCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H12BrN/c1-7-10-3-2-9(11)6-8(10)4-5-12-7/h2-3,6-7,12H,4-5H2,1H3/t7-/m1/s1 |
| InChIKey | JWPFGTSRERYDEW-SSDOTTSWSA-N |
| XLogP | 2.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |