C8H17NO2S — CID 96981211
2-[[(3R)-thian-3-yl]amino]propane-1,3-diol (PubChem CID 96981211) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-[[(3R)-thian-3-yl]amino]propane-1,3-diol.
| Compound Name | 2-[[(3R)-thian-3-yl]amino]propane-1,3-diol |
|---|---|
| PubChem CID | 96981211 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 2-[[(3R)-thian-3-yl]amino]propane-1,3-diol |
| SMILES | OCC(CO)N[C@@H]1CCCSC1 |
| InChI | InChI=1S/C8H17NO2S/c10-4-8(5-11)9-7-2-1-3-12-6-7/h7-11H,1-6H2/t7-/m1/s1 |
| InChIKey | HPFRZOXFWLDEAF-SSDOTTSWSA-N |
| XLogP | -0.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |