About 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea
1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea (PubChem CID 96995696) has the molecular formula C17H32N2O3S
and a molecular weight of 344.52 g/mol. Its IUPAC name is 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea |
| PubChem CID | 96995696 |
| Molecular Formula | C17H32N2O3S |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea |
| SMILES | CC[S@@](=O)[C@H]1CCCC[C@@H]1NC(=O)NCC1(O)CCCCCC1 |
| InChI | InChI=1S/C17H32N2O3S/c1-2-23(22)15-10-6-5-9-14(15)19-16(20)18-13-17(21)11-7-3-4-8-12-17/h14-15,21H,2-13H2,1H3,(H2,18,19,20)/t14-,15-,23+/m0/s1 |
| InChIKey | WSKHNKBXLREWCP-XAPDGSRCSA-N |
| XLogP | 2.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea?
The IUPAC name of 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea (CID 96995696) is 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea.
What is the SMILES notation for 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea?
The canonical SMILES for 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea is CC[S@@](=O)[C@H]1CCCC[C@@H]1NC(=O)NCC1(O)CCCCCC1.
What is the InChIKey of 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea?
The InChIKey is WSKHNKBXLREWCP-XAPDGSRCSA-N. The full InChI is InChI=1S/C17H32N2O3S/c1-2-23(22)15-10-6-5-9-14(15)19-16(20)18-13-17(21)11-7-3-4-8-12-17/h14-15,21H,2-13H2,1H3,(H2,18,19,20)/t14-,15-,23+/m0/s1.
What are the key properties of 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea?
1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea has a molecular weight of 344.52 g/mol, XLogP of 2.45, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-[(R)-ethylsulfinyl]cyclohexyl]-3-[(1-hydroxycycloheptyl)methyl]urea is sourced from PubChem (CID 96995696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).