C18H18Cl3N3O2S — CID 96996132
3,5,6-trichloro-N-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]pyridin-2-amine (PubChem CID 96996132) has the molecular formula C18H18Cl3N3O2S and a molecular weight of 446.79 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 96996132 |
| Molecular Formula | C18H18Cl3N3O2S |
| Molecular Weight | 446.79 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 3,5,6-trichloro-N-[(E)-1-(4-cyclopentylsulfonylphenyl)ethylideneamino]pyridin-2-amine |
| SMILES | C/C(=N\Nc1nc(Cl)c(Cl)cc1Cl)c1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C18H18Cl3N3O2S/c1-11(23-24-18-16(20)10-15(19)17(21)22-18)12-6-8-14(9-7-12)27(25,26)13-4-2-3-5-13/h6-10,13H,2-5H2,1H3,(H,22,24)/b23-11+ |
| InChIKey | GSLHEJVTWUKCFO-FOKLQQMPSA-N |
| XLogP | 5.59 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.79 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|