C10H17N3O3S — CID 96996272
5-ethyl-3-[[(2R)-oxan-2-yl]methylsulfonyl]-1H-1,2,4-triazole (PubChem CID 96996272) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-ethyl-3-[[(2R)-oxan-2-yl]methylsulfonyl]-1H-1,2,4-triazole.
| Compound Name | 5-ethyl-3-[[(2R)-oxan-2-yl]methylsulfonyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 96996272 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-ethyl-3-[[(2R)-oxan-2-yl]methylsulfonyl]-1H-1,2,4-triazole |
| SMILES | CCc1nc(S(=O)(=O)C[C@H]2CCCCO2)n[nH]1 |
| InChI | InChI=1S/C10H17N3O3S/c1-2-9-11-10(13-12-9)17(14,15)7-8-5-3-4-6-16-8/h8H,2-7H2,1H3,(H,11,12,13)/t8-/m1/s1 |
| InChIKey | YEEHGPGJTDYACJ-MRVPVSSYSA-N |
| XLogP | 0.71 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |