C18H26N4O3 — CID 96996551
N-[(1R)-1-(5-ethylfuran-2-yl)-2-methoxyethyl]-4-imidazol-1-ylpiperidine-1-carboxamide (PubChem CID 96996551) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[(1R)-1-(5-ethylfuran-2-yl)-2-methoxyethyl]-4-imidazol-1-ylpiperidine-1-carboxamide.
| Compound Name | N-[(1R)-1-(5-ethylfuran-2-yl)-2-methoxyethyl]-4-imidazol-1-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 96996551 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[(1R)-1-(5-ethylfuran-2-yl)-2-methoxyethyl]-4-imidazol-1-ylpiperidine-1-carboxamide |
| SMILES | CCc1ccc([C@@H](COC)NC(=O)N2CCC(n3ccnc3)CC2)o1 |
| InChI | InChI=1S/C18H26N4O3/c1-3-15-4-5-17(25-15)16(12-24-2)20-18(23)21-9-6-14(7-10-21)22-11-8-19-13-22/h4-5,8,11,13-14,16H,3,6-7,9-10,12H2,1-2H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | HKHUBZDAFPDPKI-MRXNPFEDSA-N |
| XLogP | 2.77 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |