About [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate
[(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate (PubChem CID 96997327) has the molecular formula C17H20N2O4
and a molecular weight of 316.36 g/mol. Its IUPAC name is [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate.
Molecular Properties
| Compound Name | [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate |
| PubChem CID | 96997327 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate |
| SMILES | CCn1c(=O)n(CC(=O)O[C@H]2CCCCC2=O)c2ccccc21 |
| InChI | InChI=1S/C17H20N2O4/c1-2-18-12-7-3-4-8-13(12)19(17(18)22)11-16(21)23-15-10-6-5-9-14(15)20/h3-4,7-8,15H,2,5-6,9-11H2,1H3/t15-/m0/s1 |
| InChIKey | NHFOQWKNJFIRGT-HNNXBMFYSA-N |
| XLogP | 1.88 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate?
The IUPAC name of [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate (CID 96997327) is [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate.
What is the SMILES notation for [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate?
The canonical SMILES for [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate is CCn1c(=O)n(CC(=O)O[C@H]2CCCCC2=O)c2ccccc21.
What is the InChIKey of [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate?
The InChIKey is NHFOQWKNJFIRGT-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H20N2O4/c1-2-18-12-7-3-4-8-13(12)19(17(18)22)11-16(21)23-15-10-6-5-9-14(15)20/h3-4,7-8,15H,2,5-6,9-11H2,1H3/t15-/m0/s1.
What are the key properties of [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate?
[(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate has a molecular weight of 316.36 g/mol, XLogP of 1.88, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-oxocyclohexyl] 2-(3-ethyl-2-oxobenzimidazol-1-yl)acetate is sourced from PubChem (CID 96997327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).