C15H27F3N4O — CID 96998575
4-ethoxy-N'-methyl-N-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide (PubChem CID 96998575) has the molecular formula C15H27F3N4O and a molecular weight of 336.40 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N'-methyl-N-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 96998575 |
| Molecular Formula | C15H27F3N4O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[(3R)-1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]piperidine-1-carboximidamide |
| SMILES | CCOC1CCN(/C(=N\C)N[C@@H]2CCN(CC(F)(F)F)C2)CC1 |
| InChI | InChI=1S/C15H27F3N4O/c1-3-23-13-5-8-22(9-6-13)14(19-2)20-12-4-7-21(10-12)11-15(16,17)18/h12-13H,3-11H2,1-2H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | DSQBSJOKOWKECX-GFCCVEGCSA-N |
| XLogP | 1.70 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|