C17H23NO4S — CID 96999263
[1-[(2R)-2-(4-methylsulfanylphenoxy)propanoyl]piperidin-4-yl] acetate (PubChem CID 96999263) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is [1-[(2R)-2-(4-methylsulfanylphenoxy)propanoyl]piperidin-4-yl] acetate.
| Compound Name | [1-[(2R)-2-(4-methylsulfanylphenoxy)propanoyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 96999263 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [1-[(2R)-2-(4-methylsulfanylphenoxy)propanoyl]piperidin-4-yl] acetate |
| SMILES | CSc1ccc(O[C@H](C)C(=O)N2CCC(OC(C)=O)CC2)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-12(21-14-4-6-16(23-3)7-5-14)17(20)18-10-8-15(9-11-18)22-13(2)19/h4-7,12,15H,8-11H2,1-3H3/t12-/m1/s1 |
| InChIKey | DXBYPHIZJATFHD-GFCCVEGCSA-N |
| XLogP | 2.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |