About [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate
[(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate (PubChem CID 97000390) has the molecular formula C15H17NO4S
and a molecular weight of 307.37 g/mol. Its IUPAC name is [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate.
Molecular Properties
| Compound Name | [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate |
| PubChem CID | 97000390 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate |
| SMILES | CS(=O)(=O)[C@H]1CC[C@H](OC(=O)c2cccc3cc[nH]c23)C1 |
| InChI | InChI=1S/C15H17NO4S/c1-21(18,19)12-6-5-11(9-12)20-15(17)13-4-2-3-10-7-8-16-14(10)13/h2-4,7-8,11-12,16H,5-6,9H2,1H3/t11-,12-/m0/s1 |
| InChIKey | KPDWMXDRMDSCQX-RYUDHWBXSA-N |
| XLogP | 2.29 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate?
The IUPAC name of [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate (CID 97000390) is [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate.
What is the SMILES notation for [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate?
The canonical SMILES for [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate is CS(=O)(=O)[C@H]1CC[C@H](OC(=O)c2cccc3cc[nH]c23)C1.
What is the InChIKey of [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate?
The InChIKey is KPDWMXDRMDSCQX-RYUDHWBXSA-N. The full InChI is InChI=1S/C15H17NO4S/c1-21(18,19)12-6-5-11(9-12)20-15(17)13-4-2-3-10-7-8-16-14(10)13/h2-4,7-8,11-12,16H,5-6,9H2,1H3/t11-,12-/m0/s1.
What are the key properties of [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate?
[(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate has a molecular weight of 307.37 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-methylsulfonylcyclopentyl] 1H-indole-7-carboxylate is sourced from PubChem (CID 97000390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).