About (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one
(5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one (PubChem CID 97000604) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one |
| PubChem CID | 97000604 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)C[C@H]1CNC(=O)O1 |
| InChI | InChI=1S/C8H15NO2/c1-8(2,3)4-6-5-9-7(10)11-6/h6H,4-5H2,1-3H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | QITDQYHNAWOLCR-LURJTMIESA-N |
| XLogP | 1.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one?
The IUPAC name of (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one (CID 97000604) is (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one?
The canonical SMILES for (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one is CC(C)(C)C[C@H]1CNC(=O)O1.
What is the InChIKey of (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one?
The InChIKey is QITDQYHNAWOLCR-LURJTMIESA-N. The full InChI is InChI=1S/C8H15NO2/c1-8(2,3)4-6-5-9-7(10)11-6/h6H,4-5H2,1-3H3,(H,9,10)/t6-/m0/s1.
What are the key properties of (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one?
(5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one has a molecular weight of 157.21 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(2,2-dimethylpropyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 97000604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).