C21H24N2O3S — CID 97000968
4-(1H-indol-3-yl)-N-[(1S)-2-methylsulfonyl-1-phenylethyl]butanamide (PubChem CID 97000968) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[(1S)-2-methylsulfonyl-1-phenylethyl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[(1S)-2-methylsulfonyl-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 97000968 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[(1S)-2-methylsulfonyl-1-phenylethyl]butanamide |
| SMILES | CS(=O)(=O)C[C@@H](NC(=O)CCCc1c[nH]c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-27(25,26)15-20(16-8-3-2-4-9-16)23-21(24)13-7-10-17-14-22-19-12-6-5-11-18(17)19/h2-6,8-9,11-12,14,20,22H,7,10,13,15H2,1H3,(H,23,24)/t20-/m1/s1 |
| InChIKey | CHFHMFIEAFCOPA-HXUWFJFHSA-N |
| XLogP | 3.39 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |