C20H24ClNO4S2 — CID 97001559
N-[(4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 97001559) has the molecular formula C20H24ClNO4S2 and a molecular weight of 442.00 g/mol. Its IUPAC name is N-[(4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[(4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 97001559 |
| Molecular Formula | C20H24ClNO4S2 |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[(4R)-6-chloro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-yl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)N[C@@H]2CCS(=O)(=O)c3ccc(Cl)cc32)c(C)c1C |
| InChI | InChI=1S/C20H24ClNO4S2/c1-11-12(2)14(4)20(15(5)13(11)3)28(25,26)22-18-8-9-27(23,24)19-7-6-16(21)10-17(18)19/h6-7,10,18,22H,8-9H2,1-5H3/t18-/m1/s1 |
| InChIKey | SKDHGYIFZCHEQC-GOSISDBHSA-N |
| XLogP | 4.08 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |