C17H29N5O3 — CID 97001775
N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-N'-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]oxamide (PubChem CID 97001775) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-N'-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]oxamide.
| Compound Name | N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-N'-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]oxamide |
|---|---|
| PubChem CID | 97001775 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-N'-[1-(2-methoxyethyl)-3,5-dimethylpyrazol-4-yl]oxamide |
| SMILES | COCCn1nc(C)c(NC(=O)C(=O)NC[C@@H](C)N(C)C2CC2)c1C |
| InChI | InChI=1S/C17H29N5O3/c1-11(21(4)14-6-7-14)10-18-16(23)17(24)19-15-12(2)20-22(13(15)3)8-9-25-5/h11,14H,6-10H2,1-5H3,(H,18,23)(H,19,24)/t11-/m1/s1 |
| InChIKey | ILVIQHUEHRUBNS-LLVKDONJSA-N |
| XLogP | 0.68 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|