About 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one
2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one (PubChem CID 97002310) has the molecular formula C16H18N4OS
and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one.
Molecular Properties
| Compound Name | 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one |
| PubChem CID | 97002310 |
| Molecular Formula | C16H18N4OS |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one |
| SMILES | CCc1ncc(CNCCn2ncc3ccccc3c2=O)s1 |
| InChI | InChI=1S/C16H18N4OS/c1-2-15-18-11-13(22-15)10-17-7-8-20-16(21)14-6-4-3-5-12(14)9-19-20/h3-6,9,11,17H,2,7-8,10H2,1H3 |
| InChIKey | CGOBKOPWYANBMF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one?
The IUPAC name of 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one (CID 97002310) is 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one.
What is the SMILES notation for 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one?
The canonical SMILES for 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one is CCc1ncc(CNCCn2ncc3ccccc3c2=O)s1.
What is the InChIKey of 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one?
The InChIKey is CGOBKOPWYANBMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N4OS/c1-2-15-18-11-13(22-15)10-17-7-8-20-16(21)14-6-4-3-5-12(14)9-19-20/h3-6,9,11,17H,2,7-8,10H2,1H3.
What are the key properties of 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one?
2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one has a molecular weight of 314.41 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(2-ethyl-1,3-thiazol-5-yl)methylamino]ethyl]phthalazin-1-one is sourced from PubChem (CID 97002310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).