C12H17NO3 — CID 97002318
N-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-2-methylfuran-3-carboxamide (PubChem CID 97002318) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is N-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 97002318 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N[C@](C)(CO)C1CC1 |
| InChI | InChI=1S/C12H17NO3/c1-8-10(5-6-16-8)11(15)13-12(2,7-14)9-3-4-9/h5-6,9,14H,3-4,7H2,1-2H3,(H,13,15)/t12-/m1/s1 |
| InChIKey | IOKMCMUOCBHPHV-GFCCVEGCSA-N |
| XLogP | 1.48 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |