C18H26N4O — CID 97002412
(3R)-3-[(2-methyl-3-phenylimidazol-4-yl)methylamino]-N-propan-2-ylbutanamide (PubChem CID 97002412) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is (3R)-3-[(2-methyl-3-phenylimidazol-4-yl)methylamino]-N-propan-2-ylbutanamide.
| Compound Name | (3R)-3-[(2-methyl-3-phenylimidazol-4-yl)methylamino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 97002412 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | (3R)-3-[(2-methyl-3-phenylimidazol-4-yl)methylamino]-N-propan-2-ylbutanamide |
| SMILES | Cc1ncc(CN[C@H](C)CC(=O)NC(C)C)n1-c1ccccc1 |
| InChI | InChI=1S/C18H26N4O/c1-13(2)21-18(23)10-14(3)19-11-17-12-20-15(4)22(17)16-8-6-5-7-9-16/h5-9,12-14,19H,10-11H2,1-4H3,(H,21,23)/t14-/m1/s1 |
| InChIKey | KSOKFKDHGQIVKR-CQSZACIVSA-N |
| XLogP | 2.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |