C16H16FN3O2S — CID 97002751
(5S)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 97002751) has the molecular formula C16H16FN3O2S and a molecular weight of 333.39 g/mol. Its IUPAC name is (5S)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 97002751 |
| Molecular Formula | C16H16FN3O2S |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (5S)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]-1-(4-fluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1nc(CN2C(=O)[C@H](C)N(c3ccc(F)cc3)C2=O)sc1C |
| InChI | InChI=1S/C16H16FN3O2S/c1-9-11(3)23-14(18-9)8-19-15(21)10(2)20(16(19)22)13-6-4-12(17)5-7-13/h4-7,10H,8H2,1-3H3/t10-/m0/s1 |
| InChIKey | OKPGGUUWMLXAFB-JTQLQIEISA-N |
| XLogP | 3.26 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|