About 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea
1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea (PubChem CID 97005332) has the molecular formula C11H17F3N2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea.
Molecular Properties
| Compound Name | 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea |
| PubChem CID | 97005332 |
| Molecular Formula | C11H17F3N2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea |
| SMILES | FC(F)(F)[C@@H]1CCCC[C@H]1NC(=S)NC1CC1 |
| InChI | InChI=1S/C11H17F3N2S/c12-11(13,14)8-3-1-2-4-9(8)16-10(17)15-7-5-6-7/h7-9H,1-6H2,(H2,15,16,17)/t8-,9-/m1/s1 |
| InChIKey | DQPYURCJHSPKEC-RKDXNWHRSA-N |
| XLogP | 2.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea?
The IUPAC name of 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea (CID 97005332) is 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea.
What is the SMILES notation for 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea?
The canonical SMILES for 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea is FC(F)(F)[C@@H]1CCCC[C@H]1NC(=S)NC1CC1.
What is the InChIKey of 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea?
The InChIKey is DQPYURCJHSPKEC-RKDXNWHRSA-N. The full InChI is InChI=1S/C11H17F3N2S/c12-11(13,14)8-3-1-2-4-9(8)16-10(17)15-7-5-6-7/h7-9H,1-6H2,(H2,15,16,17)/t8-,9-/m1/s1.
What are the key properties of 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea?
1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea has a molecular weight of 266.33 g/mol, XLogP of 2.73, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-3-[(1R,2R)-2-(trifluoromethyl)cyclohexyl]thiourea is sourced from PubChem (CID 97005332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).