C22H26FN3O3S — CID 97006890
1-N'-(4-fluorophenyl)-1-N-[(2R)-2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]cyclopropane-1,1-dicarboxamide (PubChem CID 97006890) has the molecular formula C22H26FN3O3S and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-N'-(4-fluorophenyl)-1-N-[(2R)-2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-(4-fluorophenyl)-1-N-[(2R)-2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 97006890 |
| Molecular Formula | C22H26FN3O3S |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 1-N'-(4-fluorophenyl)-1-N-[(2R)-2-(5-methylthiophen-2-yl)-2-morpholin-4-ylethyl]cyclopropane-1,1-dicarboxamide |
| SMILES | Cc1ccc([C@@H](CNC(=O)C2(C(=O)Nc3ccc(F)cc3)CC2)N2CCOCC2)s1 |
| InChI | InChI=1S/C22H26FN3O3S/c1-15-2-7-19(30-15)18(26-10-12-29-13-11-26)14-24-20(27)22(8-9-22)21(28)25-17-5-3-16(23)4-6-17/h2-7,18H,8-14H2,1H3,(H,24,27)(H,25,28)/t18-/m1/s1 |
| InChIKey | TYQZCLVRLYHCOD-GOSISDBHSA-N |
| XLogP | 3.10 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|