C25H34N4O2 — CID 97007489
N-(2-tert-butylpyrimidin-5-yl)-N'-[(R)-[(1R,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide (PubChem CID 97007489) has the molecular formula C25H34N4O2 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-(2-tert-butylpyrimidin-5-yl)-N'-[(R)-[(1R,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide.
| Compound Name | N-(2-tert-butylpyrimidin-5-yl)-N'-[(R)-[(1R,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 97007489 |
| Molecular Formula | C25H34N4O2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | N-(2-tert-butylpyrimidin-5-yl)-N'-[(R)-[(1R,3S)-3-methylcyclohexyl]-(2-methylphenyl)methyl]oxamide |
| SMILES | Cc1ccccc1[C@H](NC(=O)C(=O)Nc1cnc(C(C)(C)C)nc1)[C@@H]1CCC[C@H](C)C1 |
| InChI | InChI=1S/C25H34N4O2/c1-16-9-8-11-18(13-16)21(20-12-7-6-10-17(20)2)29-23(31)22(30)28-19-14-26-24(27-15-19)25(3,4)5/h6-7,10,12,14-16,18,21H,8-9,11,13H2,1-5H3,(H,28,30)(H,29,31)/t16-,18+,21+/m0/s1 |
| InChIKey | QESMUMSYLVWZFD-YRISNDGFSA-N |
| XLogP | 4.70 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|