C15H18N6OS — CID 97009472
1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]methanamine (PubChem CID 97009472) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is 1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]methanamine.
| Compound Name | 1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]methanamine |
|---|---|
| PubChem CID | 97009472 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]methanamine |
| SMILES | Cc1nnc2n1C[C@H](CNCc1nc(-c3cccs3)no1)CC2 |
| InChI | InChI=1S/C15H18N6OS/c1-10-18-19-13-5-4-11(9-21(10)13)7-16-8-14-17-15(20-22-14)12-3-2-6-23-12/h2-3,6,11,16H,4-5,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | UIXPEAUZUCHWOU-NSHDSACASA-N |
| XLogP | 2.05 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |