C17H15F3N2O2 — CID 97009751
1-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-methylbenzimidazol-2-one (PubChem CID 97009751) has the molecular formula C17H15F3N2O2 and a molecular weight of 336.31 g/mol. Its IUPAC name is 1-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-methylbenzimidazol-2-one.
| Compound Name | 1-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-methylbenzimidazol-2-one |
|---|---|
| PubChem CID | 97009751 |
| Molecular Formula | C17H15F3N2O2 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-[(2S)-2-hydroxy-2-[2-(trifluoromethyl)phenyl]ethyl]-3-methylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C[C@@H](O)c2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C17H15F3N2O2/c1-21-13-8-4-5-9-14(13)22(16(21)24)10-15(23)11-6-2-3-7-12(11)17(18,19)20/h2-9,15,23H,10H2,1H3/t15-/m1/s1 |
| InChIKey | YYCLPFNHYGWWRB-OAHLLOKOSA-N |
| XLogP | 3.09 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |