About (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane
(5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane (PubChem CID 97010540) has the molecular formula C12H15N5O
and a molecular weight of 245.29 g/mol. Its IUPAC name is (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane |
| PubChem CID | 97010540 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane |
| SMILES | c1nc(N2CC[C@]3(CCOC3)C2)c2cn[nH]c2n1 |
| InChI | InChI=1S/C12H15N5O/c1-3-17(6-12(1)2-4-18-7-12)11-9-5-15-16-10(9)13-8-14-11/h5,8H,1-4,6-7H2,(H,13,14,15,16)/t12-/m0/s1 |
| InChIKey | JIQFTGIRYZZRHC-LBPRGKRZSA-N |
| XLogP | 0.97 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane?
The IUPAC name of (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane (CID 97010540) is (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane.
What is the SMILES notation for (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane?
The canonical SMILES for (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane is c1nc(N2CC[C@]3(CCOC3)C2)c2cn[nH]c2n1.
What is the InChIKey of (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane?
The InChIKey is JIQFTGIRYZZRHC-LBPRGKRZSA-N. The full InChI is InChI=1S/C12H15N5O/c1-3-17(6-12(1)2-4-18-7-12)11-9-5-15-16-10(9)13-8-14-11/h5,8H,1-4,6-7H2,(H,13,14,15,16)/t12-/m0/s1.
What are the key properties of (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane?
(5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane has a molecular weight of 245.29 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-7-(1H-pyrazolo[5,4-d]pyrimidin-4-yl)-2-oxa-7-azaspiro[4.4]nonane is sourced from PubChem (CID 97010540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).