C9H18O2 — CID 97010857
[(2R,4S)-2-propan-2-yloxan-4-yl]methanol (PubChem CID 97010857) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is [(2R,4S)-2-propan-2-yloxan-4-yl]methanol.
| Compound Name | [(2R,4S)-2-propan-2-yloxan-4-yl]methanol |
|---|---|
| PubChem CID | 97010857 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | [(2R,4S)-2-propan-2-yloxan-4-yl]methanol |
| SMILES | CC(C)[C@H]1C[C@@H](CO)CCO1 |
| InChI | InChI=1S/C9H18O2/c1-7(2)9-5-8(6-10)3-4-11-9/h7-10H,3-6H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | NJOJKZIRFDRORU-DTWKUNHWSA-N |
| XLogP | 1.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |