C20H21FN2O2 — CID 97011036
3-[[(2S)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]methyl]benzamide (PubChem CID 97011036) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[[(2S)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]methyl]benzamide.
| Compound Name | 3-[[(2S)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 97011036 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[[(2S)-2-[2-(4-fluorophenyl)-2-oxoethyl]pyrrolidin-1-yl]methyl]benzamide |
| SMILES | NC(=O)c1cccc(CN2CCC[C@H]2CC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H21FN2O2/c21-17-8-6-15(7-9-17)19(24)12-18-5-2-10-23(18)13-14-3-1-4-16(11-14)20(22)25/h1,3-4,6-9,11,18H,2,5,10,12-13H2,(H2,22,25)/t18-/m0/s1 |
| InChIKey | PGIDJARQYWAPQV-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |