C22H22Cl2N2O3 — CID 97012183
1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropanecarbonyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 97012183) has the molecular formula C22H22Cl2N2O3 and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropanecarbonyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropanecarbonyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 97012183 |
| Molecular Formula | C22H22Cl2N2O3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 1-[(1R,2S)-2-(3,4-dichlorophenyl)cyclopropanecarbonyl]-N-(4-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1)C1CCN(C(=O)[C@@H]2C[C@@H]2c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C22H22Cl2N2O3/c23-19-6-1-14(11-20(19)24)17-12-18(17)22(29)26-9-7-13(8-10-26)21(28)25-15-2-4-16(27)5-3-15/h1-6,11,13,17-18,27H,7-10,12H2,(H,25,28)/t17-,18-/m1/s1 |
| InChIKey | IUQSHRDIQKHRPX-QZTJIDSGSA-N |
| XLogP | 4.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|