C19H22N4 — CID 97013821
1-ethyl-2-[(2R)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]benzimidazole (PubChem CID 97013821) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-ethyl-2-[(2R)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]benzimidazole.
| Compound Name | 1-ethyl-2-[(2R)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]benzimidazole |
|---|---|
| PubChem CID | 97013821 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 1-ethyl-2-[(2R)-1-(pyridin-3-ylmethyl)pyrrolidin-2-yl]benzimidazole |
| SMILES | CCn1c([C@H]2CCCN2Cc2cccnc2)nc2ccccc21 |
| InChI | InChI=1S/C19H22N4/c1-2-23-17-9-4-3-8-16(17)21-19(23)18-10-6-12-22(18)14-15-7-5-11-20-13-15/h3-5,7-9,11,13,18H,2,6,10,12,14H2,1H3/t18-/m1/s1 |
| InChIKey | LSADNOJPKDCRFQ-GOSISDBHSA-N |
| XLogP | 3.79 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |