C24H30N2O4 — CID 97014789
(3R)-N-(4-cyclopentyloxyphenyl)-3-[(2S)-2-hydroxy-2-phenylethyl]morpholine-4-carboxamide (PubChem CID 97014789) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is (3R)-N-(4-cyclopentyloxyphenyl)-3-[(2S)-2-hydroxy-2-phenylethyl]morpholine-4-carboxamide.
| Compound Name | (3R)-N-(4-cyclopentyloxyphenyl)-3-[(2S)-2-hydroxy-2-phenylethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 97014789 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (3R)-N-(4-cyclopentyloxyphenyl)-3-[(2S)-2-hydroxy-2-phenylethyl]morpholine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CCCC2)cc1)N1CCOC[C@H]1C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O4/c27-23(18-6-2-1-3-7-18)16-20-17-29-15-14-26(20)24(28)25-19-10-12-22(13-11-19)30-21-8-4-5-9-21/h1-3,6-7,10-13,20-21,23,27H,4-5,8-9,14-17H2,(H,25,28)/t20-,23+/m1/s1 |
| InChIKey | OVLPLWIFZGOFNP-OFNKIYASSA-N |
| XLogP | 4.36 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |