C20H28N2O3 — CID 97015300
1-[(2R)-2-benzylpiperidin-1-yl]-4-morpholin-4-ylbutane-1,4-dione (PubChem CID 97015300) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-[(2R)-2-benzylpiperidin-1-yl]-4-morpholin-4-ylbutane-1,4-dione.
| Compound Name | 1-[(2R)-2-benzylpiperidin-1-yl]-4-morpholin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 97015300 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(2R)-2-benzylpiperidin-1-yl]-4-morpholin-4-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCCC[C@@H]1Cc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H28N2O3/c23-19(21-12-14-25-15-13-21)9-10-20(24)22-11-5-4-8-18(22)16-17-6-2-1-3-7-17/h1-3,6-7,18H,4-5,8-16H2/t18-/m1/s1 |
| InChIKey | MHTYKFIZWDSKQY-GOSISDBHSA-N |
| XLogP | 2.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |