About (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate
(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate (PubChem CID 97016585) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate.
Molecular Properties
| Compound Name | (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate |
| PubChem CID | 97016585 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate |
| SMILES | O=C(OCc1nn(-c2ccccc2)c2c1CCC2)[C@@H]1COCCO1 |
| InChI | InChI=1S/C18H20N2O4/c21-18(17-12-22-9-10-23-17)24-11-15-14-7-4-8-16(14)20(19-15)13-5-2-1-3-6-13/h1-3,5-6,17H,4,7-12H2/t17-/m0/s1 |
| InChIKey | STVJOOKJSBGWEM-KRWDZBQOSA-N |
| XLogP | 1.82 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate?
The IUPAC name of (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate (CID 97016585) is (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate.
What is the SMILES notation for (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate?
The canonical SMILES for (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate is O=C(OCc1nn(-c2ccccc2)c2c1CCC2)[C@@H]1COCCO1.
What is the InChIKey of (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate?
The InChIKey is STVJOOKJSBGWEM-KRWDZBQOSA-N. The full InChI is InChI=1S/C18H20N2O4/c21-18(17-12-22-9-10-23-17)24-11-15-14-7-4-8-16(14)20(19-15)13-5-2-1-3-6-13/h1-3,5-6,17H,4,7-12H2/t17-/m0/s1.
What are the key properties of (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate?
(1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate has a molecular weight of 328.37 g/mol, XLogP of 1.82, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-3-yl)methyl (2S)-1,4-dioxane-2-carboxylate is sourced from PubChem (CID 97016585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).