C18H16F3NO2S — CID 97017077
N-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 97017077) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is N-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 97017077 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-cyclopropyl-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1F)N(C1CC1)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C18H16F3NO2S/c19-14-8-10-16(18(21)17(14)20)25(23,24)22(12-6-7-12)15-9-5-11-3-1-2-4-13(11)15/h1-4,8,10,12,15H,5-7,9H2/t15-/m1/s1 |
| InChIKey | GGMNOLATIYPJCZ-OAHLLOKOSA-N |
| XLogP | 3.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|