C12H24N2OS — CID 97017596
(2S)-N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methylsulfanylpropanamide (PubChem CID 97017596) has the molecular formula C12H24N2OS and a molecular weight of 244.40 g/mol. Its IUPAC name is (2S)-N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methylsulfanylpropanamide.
| Compound Name | (2S)-N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 97017596 |
| Molecular Formula | C12H24N2OS |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2S)-N-[2-[cyclopropyl(propan-2-yl)amino]ethyl]-2-methylsulfanylpropanamide |
| SMILES | CS[C@@H](C)C(=O)NCCN(C(C)C)C1CC1 |
| InChI | InChI=1S/C12H24N2OS/c1-9(2)14(11-5-6-11)8-7-13-12(15)10(3)16-4/h9-11H,5-8H2,1-4H3,(H,13,15)/t10-/m0/s1 |
| InChIKey | PZONMNMTNYWNPE-JTQLQIEISA-N |
| XLogP | 1.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |