C13H20F3N3O3 — CID 97017664
(5S)-3-propan-2-yl-7-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 97017664) has the molecular formula C13H20F3N3O3 and a molecular weight of 323.32 g/mol. Its IUPAC name is (5S)-3-propan-2-yl-7-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-3-propan-2-yl-7-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 97017664 |
| Molecular Formula | C13H20F3N3O3 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (5S)-3-propan-2-yl-7-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | CC(C)N1C(=O)N[C@]2(CCN(CCOCC(F)(F)F)C2)C1=O |
| InChI | InChI=1S/C13H20F3N3O3/c1-9(2)19-10(20)12(17-11(19)21)3-4-18(7-12)5-6-22-8-13(14,15)16/h9H,3-8H2,1-2H3,(H,17,21)/t12-/m0/s1 |
| InChIKey | QFJQUROVBKUKDE-LBPRGKRZSA-N |
| XLogP | 0.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|