C16H19N7O2 — CID 97018940
[(2S)-2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)morpholin-4-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone (PubChem CID 97018940) has the molecular formula C16H19N7O2 and a molecular weight of 341.38 g/mol. Its IUPAC name is [(2S)-2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)morpholin-4-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone.
| Compound Name | [(2S)-2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)morpholin-4-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone |
|---|---|
| PubChem CID | 97018940 |
| Molecular Formula | C16H19N7O2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [(2S)-2-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)morpholin-4-yl]-([1,2,4]triazolo[4,3-a]pyridin-6-yl)methanone |
| SMILES | CC(C)c1n[nH]c([C@@H]2CN(C(=O)c3ccc4nncn4c3)CCO2)n1 |
| InChI | InChI=1S/C16H19N7O2/c1-10(2)14-18-15(21-20-14)12-8-22(5-6-25-12)16(24)11-3-4-13-19-17-9-23(13)7-11/h3-4,7,9-10,12H,5-6,8H2,1-2H3,(H,18,20,21)/t12-/m0/s1 |
| InChIKey | GSCNTBRUPIGFAS-LBPRGKRZSA-N |
| XLogP | 1.18 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |