C19H33N3S — CID 97019140
1-[(1S)-1-(1-adamantyl)ethyl]-3-(1-methylpiperidin-4-yl)thiourea (PubChem CID 97019140) has the molecular formula C19H33N3S and a molecular weight of 335.56 g/mol. Its IUPAC name is 1-[(1S)-1-(1-adamantyl)ethyl]-3-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 1-[(1S)-1-(1-adamantyl)ethyl]-3-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 97019140 |
| Molecular Formula | C19H33N3S |
| Molecular Weight | 335.56 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 1-[(1S)-1-(1-adamantyl)ethyl]-3-(1-methylpiperidin-4-yl)thiourea |
| SMILES | C[C@H](NC(=S)NC1CCN(C)CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H33N3S/c1-13(20-18(23)21-17-3-5-22(2)6-4-17)19-10-14-7-15(11-19)9-16(8-14)12-19/h13-17H,3-12H2,1-2H3,(H2,20,21,23)/t13-,14?,15?,16?,19?/m0/s1 |
| InChIKey | DVOIRFWKDLJNMH-IWUURBKTSA-N |
| XLogP | 3.15 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.56 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|