C18H17Cl2N3O2 — CID 97019777
4-chloro-2-(4-chlorophenyl)-5-[[(2R)-4-(furan-2-yl)butan-2-yl]amino]pyridazin-3-one (PubChem CID 97019777) has the molecular formula C18H17Cl2N3O2 and a molecular weight of 378.26 g/mol. Its IUPAC name is 4-chloro-2-(4-chlorophenyl)-5-[[(2R)-4-(furan-2-yl)butan-2-yl]amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(4-chlorophenyl)-5-[[(2R)-4-(furan-2-yl)butan-2-yl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 97019777 |
| Molecular Formula | C18H17Cl2N3O2 |
| Molecular Weight | 378.26 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-chloro-2-(4-chlorophenyl)-5-[[(2R)-4-(furan-2-yl)butan-2-yl]amino]pyridazin-3-one |
| SMILES | C[C@H](CCc1ccco1)Nc1cnn(-c2ccc(Cl)cc2)c(=O)c1Cl |
| InChI | InChI=1S/C18H17Cl2N3O2/c1-12(4-9-15-3-2-10-25-15)22-16-11-21-23(18(24)17(16)20)14-7-5-13(19)6-8-14/h2-3,5-8,10-12,22H,4,9H2,1H3/t12-/m1/s1 |
| InChIKey | PKBRMXRALHEBCM-GFCCVEGCSA-N |
| XLogP | 4.57 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |