C17H14ClFN4O3 — CID 97021769
N-(2-chloro-4-fluorophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]acetamide (PubChem CID 97021769) has the molecular formula C17H14ClFN4O3 and a molecular weight of 376.78 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 97021769 |
| Molecular Formula | C17H14ClFN4O3 |
| Molecular Weight | 376.78 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[(4R)-4-methyl-2,5-dioxo-4-pyridin-2-ylimidazolidin-1-yl]acetamide |
| SMILES | C[C@]1(c2ccccn2)NC(=O)N(CC(=O)Nc2ccc(F)cc2Cl)C1=O |
| InChI | InChI=1S/C17H14ClFN4O3/c1-17(13-4-2-3-7-20-13)15(25)23(16(26)22-17)9-14(24)21-12-6-5-10(19)8-11(12)18/h2-8H,9H2,1H3,(H,21,24)(H,22,26)/t17-/m1/s1 |
| InChIKey | OQQKPRYWHGCQSJ-QGZVFWFLSA-N |
| XLogP | 2.28 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|