C15H15F4N3 — CID 97021869
N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 97021869) has the molecular formula C15H15F4N3 and a molecular weight of 313.30 g/mol. Its IUPAC name is N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 97021869 |
| Molecular Formula | C15H15F4N3 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[(E)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CC1(C)[C@@H]2CC=C(/C=N/Nc3c(F)c(F)nc(F)c3F)[C@H]1C2 |
| InChI | InChI=1S/C15H15F4N3/c1-15(2)8-4-3-7(9(15)5-8)6-20-22-12-10(16)13(18)21-14(19)11(12)17/h3,6,8-9H,4-5H2,1-2H3,(H,21,22)/b20-6+/t8-,9-/m1/s1 |
| InChIKey | DOVAPWKKNHJXIX-UZZNNJLMSA-N |
| XLogP | 4.03 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|