C19H26N2O2 — CID 97022014
3-[[[(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-methylamino]methyl]benzamide (PubChem CID 97022014) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[[[(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-methylamino]methyl]benzamide.
| Compound Name | 3-[[[(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 97022014 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 3-[[[(1S,3S)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarbonyl]-methylamino]methyl]benzamide |
| SMILES | CC(C)=C[C@H]1[C@H](C(=O)N(C)Cc2cccc(C(N)=O)c2)C1(C)C |
| InChI | InChI=1S/C19H26N2O2/c1-12(2)9-15-16(19(15,3)4)18(23)21(5)11-13-7-6-8-14(10-13)17(20)22/h6-10,15-16H,11H2,1-5H3,(H2,20,22)/t15-,16+/m0/s1 |
| InChIKey | RHWYIVJBFBUZQB-JKSUJKDBSA-N |
| XLogP | 2.98 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|