C12H24O3S — CID 97022789
2-[2-[(3R,5R)-3,5-dimethylcyclohexyl]ethylsulfonyl]ethanol (PubChem CID 97022789) has the molecular formula C12H24O3S and a molecular weight of 248.39 g/mol. Its IUPAC name is 2-[2-[(3R,5R)-3,5-dimethylcyclohexyl]ethylsulfonyl]ethanol.
| Compound Name | 2-[2-[(3R,5R)-3,5-dimethylcyclohexyl]ethylsulfonyl]ethanol |
|---|---|
| PubChem CID | 97022789 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2-[2-[(3R,5R)-3,5-dimethylcyclohexyl]ethylsulfonyl]ethanol |
| SMILES | C[C@H]1CC(CCS(=O)(=O)CCO)C[C@H](C)C1 |
| InChI | InChI=1S/C12H24O3S/c1-10-7-11(2)9-12(8-10)3-5-16(14,15)6-4-13/h10-13H,3-9H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | DWDDYXLHIPJTQV-GHMZBOCLSA-N |
| XLogP | 1.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |