C20H20Cl3N3O2 — CID 97023352
3,6-dichloro-N-[4-chloro-2-[(2S,6S)-2,6-dimethylpiperidine-1-carbonyl]phenyl]pyridine-2-carboxamide (PubChem CID 97023352) has the molecular formula C20H20Cl3N3O2 and a molecular weight of 440.76 g/mol. Its IUPAC name is 3,6-dichloro-N-[4-chloro-2-[(2S,6S)-2,6-dimethylpiperidine-1-carbonyl]phenyl]pyridine-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[4-chloro-2-[(2S,6S)-2,6-dimethylpiperidine-1-carbonyl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 97023352 |
| Molecular Formula | C20H20Cl3N3O2 |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 3,6-dichloro-N-[4-chloro-2-[(2S,6S)-2,6-dimethylpiperidine-1-carbonyl]phenyl]pyridine-2-carboxamide |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)c1cc(Cl)ccc1NC(=O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H20Cl3N3O2/c1-11-4-3-5-12(2)26(11)20(28)14-10-13(21)6-8-16(14)24-19(27)18-15(22)7-9-17(23)25-18/h6-12H,3-5H2,1-2H3,(H,24,27)/t11-,12-/m0/s1 |
| InChIKey | VLTGEFMKVGXGSH-RYUDHWBXSA-N |
| XLogP | 5.70 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|